C8H12O7P2 — CID 156695434
2-[hydroxy-(4-hydroxyphenoxy)phosphoryl]ethylphosphonic acid (PubChem CID 156695434) has the molecular formula C8H12O7P2 and a molecular weight of 282.12 g/mol. Its IUPAC name is 2-[hydroxy-(4-hydroxyphenoxy)phosphoryl]ethylphosphonic acid.
| Compound Name | 2-[hydroxy-(4-hydroxyphenoxy)phosphoryl]ethylphosphonic acid |
|---|---|
| PubChem CID | 156695434 |
| Molecular Formula | C8H12O7P2 |
| Molecular Weight | 282.12 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 2-[hydroxy-(4-hydroxyphenoxy)phosphoryl]ethylphosphonic acid |
| SMILES | O=P(O)(O)CCP(=O)(O)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C8H12O7P2/c9-7-1-3-8(4-2-7)15-17(13,14)6-5-16(10,11)12/h1-4,9H,5-6H2,(H,13,14)(H2,10,11,12) |
| InChIKey | GFFNPGXEGLOGCT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.12 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|