C7H11NO7P2 — CID 87619380
[hydroxy-(4-hydroxyanilino)oxyphosphoryl]methylphosphonic acid (PubChem CID 87619380) has the molecular formula C7H11NO7P2 and a molecular weight of 283.11 g/mol. Its IUPAC name is [hydroxy-(4-hydroxyanilino)oxyphosphoryl]methylphosphonic acid.
| Compound Name | [hydroxy-(4-hydroxyanilino)oxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 87619380 |
| Molecular Formula | C7H11NO7P2 |
| Molecular Weight | 283.11 g/mol |
| Exact Mass | 283.00 |
| IUPAC Name | [hydroxy-(4-hydroxyanilino)oxyphosphoryl]methylphosphonic acid |
| SMILES | O=P(O)(O)CP(=O)(O)ONc1ccc(O)cc1 |
| InChI | InChI=1S/C7H11NO7P2/c9-7-3-1-6(2-4-7)8-15-17(13,14)5-16(10,11)12/h1-4,8-9H,5H2,(H,13,14)(H2,10,11,12) |
| InChIKey | PRYGSFPCQPBZAI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 136.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.11 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|