C7H15ClN2O2 — CID 156695446
methyl N-[(3-aminocyclobutyl)methyl]carbamate;hydrochloride (PubChem CID 156695446) has the molecular formula C7H15ClN2O2 and a molecular weight of 194.66 g/mol. Its IUPAC name is methyl N-[(3-aminocyclobutyl)methyl]carbamate;hydrochloride.
| Compound Name | methyl N-[(3-aminocyclobutyl)methyl]carbamate;hydrochloride |
|---|---|
| PubChem CID | 156695446 |
| Molecular Formula | C7H15ClN2O2 |
| Molecular Weight | 194.66 g/mol |
| Exact Mass | 194.08 |
| IUPAC Name | methyl N-[(3-aminocyclobutyl)methyl]carbamate;hydrochloride |
| SMILES | COC(=O)NCC1CC(N)C1.Cl |
| InChI | InChI=1S/C7H14N2O2.ClH/c1-11-7(10)9-4-5-2-6(8)3-5;/h5-6H,2-4,8H2,1H3,(H,9,10);1H |
| InChIKey | DZERQAJFXBFLRU-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.66 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |