C30H25BrF3N3O4 — CID 156695719
4-[4-[[4-bromo-1-(2-morpholin-4-ylethyl)-2-oxoindol-3-ylidene]methyl]-3-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 156695719) has the molecular formula C30H25BrF3N3O4 and a molecular weight of 628.45 g/mol. Its IUPAC name is 4-[4-[[4-bromo-1-(2-morpholin-4-ylethyl)-2-oxoindol-3-ylidene]methyl]-3-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-[[4-bromo-1-(2-morpholin-4-ylethyl)-2-oxoindol-3-ylidene]methyl]-3-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 156695719 |
| Molecular Formula | C30H25BrF3N3O4 |
| Molecular Weight | 628.45 g/mol |
| Exact Mass | 627.10 |
| IUPAC Name | 4-[4-[[4-bromo-1-(2-morpholin-4-ylethyl)-2-oxoindol-3-ylidene]methyl]-3-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | COc1cc(Oc2ccc(C#N)cc2C(F)(F)F)ccc1C=C1C(=O)N(CCN2CCOCC2)c2cccc(Br)c21 |
| InChI | InChI=1S/C30H25BrF3N3O4/c1-39-27-17-21(41-26-8-5-19(18-35)15-23(26)30(32,33)34)7-6-20(27)16-22-28-24(31)3-2-4-25(28)37(29(22)38)10-9-36-11-13-40-14-12-36/h2-8,15-17H,9-14H2,1H3 |
| InChIKey | RTVNBACZTJHMKO-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 75.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.45 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|