C25H17F3N2O3 — CID 156695744
4-[3-methoxy-4-[(4-methyl-2-oxo-1H-indol-3-ylidene)methyl]phenoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 156695744) has the molecular formula C25H17F3N2O3 and a molecular weight of 450.42 g/mol. Its IUPAC name is 4-[3-methoxy-4-[(4-methyl-2-oxo-1H-indol-3-ylidene)methyl]phenoxy]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[3-methoxy-4-[(4-methyl-2-oxo-1H-indol-3-ylidene)methyl]phenoxy]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 156695744 |
| Molecular Formula | C25H17F3N2O3 |
| Molecular Weight | 450.42 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | 4-[3-methoxy-4-[(4-methyl-2-oxo-1H-indol-3-ylidene)methyl]phenoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | COc1cc(Oc2ccc(C#N)cc2C(F)(F)F)ccc1C=C1C(=O)Nc2cccc(C)c21 |
| InChI | InChI=1S/C25H17F3N2O3/c1-14-4-3-5-20-23(14)18(24(31)30-20)11-16-7-8-17(12-22(16)32-2)33-21-9-6-15(13-29)10-19(21)25(26,27)28/h3-12H,1-2H3,(H,30,31) |
| InChIKey | WQURSDRMWBYCFT-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.42 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|