C24H14F4N2O3 — CID 156695749
4-[4-[(4-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-3-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile (PubChem CID 156695749) has the molecular formula C24H14F4N2O3 and a molecular weight of 454.38 g/mol. Its IUPAC name is 4-[4-[(4-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-3-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[4-[(4-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-3-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 156695749 |
| Molecular Formula | C24H14F4N2O3 |
| Molecular Weight | 454.38 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | 4-[4-[(4-fluoro-2-oxo-1H-indol-3-ylidene)methyl]-3-methoxyphenoxy]-3-(trifluoromethyl)benzonitrile |
| SMILES | COc1cc(Oc2ccc(C#N)cc2C(F)(F)F)ccc1C=C1C(=O)Nc2cccc(F)c21 |
| InChI | InChI=1S/C24H14F4N2O3/c1-32-21-11-15(33-20-8-5-13(12-29)9-17(20)24(26,27)28)7-6-14(21)10-16-22-18(25)3-2-4-19(22)30-23(16)31/h2-11H,1H3,(H,30,31) |
| InChIKey | SUXWLLQICABXOX-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.38 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|