C17H19N3O4 — CID 156696053
6-methoxy-N-(3,4,5-trimethoxyphenyl)-1H-indazol-3-amine (PubChem CID 156696053) has the molecular formula C17H19N3O4 and a molecular weight of 329.36 g/mol. Its IUPAC name is 6-methoxy-N-(3,4,5-trimethoxyphenyl)-1H-indazol-3-amine.
| Compound Name | 6-methoxy-N-(3,4,5-trimethoxyphenyl)-1H-indazol-3-amine |
|---|---|
| PubChem CID | 156696053 |
| Molecular Formula | C17H19N3O4 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 6-methoxy-N-(3,4,5-trimethoxyphenyl)-1H-indazol-3-amine |
| SMILES | COc1ccc2c(Nc3cc(OC)c(OC)c(OC)c3)n[nH]c2c1 |
| InChI | InChI=1S/C17H19N3O4/c1-21-11-5-6-12-13(9-11)19-20-17(12)18-10-7-14(22-2)16(24-4)15(8-10)23-3/h5-9H,1-4H3,(H2,18,19,20) |
| InChIKey | MFDHCUUHJXOURA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |