C16H17N3O3 — CID 162654743
N-(3,5-dimethoxyphenyl)-6-methoxy-1H-indazol-3-amine (PubChem CID 162654743) has the molecular formula C16H17N3O3 and a molecular weight of 299.33 g/mol. Its IUPAC name is N-(3,5-dimethoxyphenyl)-6-methoxy-1H-indazol-3-amine.
| Compound Name | N-(3,5-dimethoxyphenyl)-6-methoxy-1H-indazol-3-amine |
|---|---|
| PubChem CID | 162654743 |
| Molecular Formula | C16H17N3O3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | N-(3,5-dimethoxyphenyl)-6-methoxy-1H-indazol-3-amine |
| SMILES | COc1cc(Nc2n[nH]c3cc(OC)ccc23)cc(OC)c1 |
| InChI | InChI=1S/C16H17N3O3/c1-20-11-4-5-14-15(9-11)18-19-16(14)17-10-6-12(21-2)8-13(7-10)22-3/h4-9H,1-3H3,(H2,17,18,19) |
| InChIKey | JYNSPAJSKRLDCH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 68.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |