C24H36O4 — CID 156696789
(10R,11S,13S,17S)-10,11,13-trimethyl-17-(2-methyl-1,3-dioxol-2-yl)-1,2,3,4,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,11-diol (PubChem CID 156696789) has the molecular formula C24H36O4 and a molecular weight of 388.55 g/mol. Its IUPAC name is (10R,11S,13S,17S)-10,11,13-trimethyl-17-(2-methyl-1,3-dioxol-2-yl)-1,2,3,4,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,11-diol.
| Compound Name | (10R,11S,13S,17S)-10,11,13-trimethyl-17-(2-methyl-1,3-dioxol-2-yl)-1,2,3,4,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,11-diol |
|---|---|
| PubChem CID | 156696789 |
| Molecular Formula | C24H36O4 |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.26 |
| IUPAC Name | (10R,11S,13S,17S)-10,11,13-trimethyl-17-(2-methyl-1,3-dioxol-2-yl)-1,2,3,4,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,11-diol |
| SMILES | CC1(O)C[C@@]2(C)C(CC[C@@H]2C2(C)OC=CO2)C2CC=C3CC(O)CC[C@]3(C)C21 |
| InChI | InChI=1S/C24H36O4/c1-21-10-9-16(25)13-15(21)5-6-17-18-7-8-19(24(4)27-11-12-28-24)22(18,2)14-23(3,26)20(17)21/h5,11-12,16-20,25-26H,6-10,13-14H2,1-4H3/t16?,17?,18?,19-,20?,21-,22-,23?/m0/s1 |
| InChIKey | JZEYEIQQDNPOKN-FFOIMHTGSA-N |
| XLogP | 4.52 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|