C23H35NO4 — CID 145003619
10-hydroxy-9a,10,11a-trimethyl-1-(2-methyl-1,3-dioxolan-2-yl)-2,3,3a,3b,4,6,8,9,9b,11-decahydro-1H-indeno[5,4-f]quinolin-7-one (PubChem CID 145003619) has the molecular formula C23H35NO4 and a molecular weight of 389.54 g/mol. Its IUPAC name is 10-hydroxy-9a,10,11a-trimethyl-1-(2-methyl-1,3-dioxolan-2-yl)-2,3,3a,3b,4,6,8,9,9b,11-decahydro-1H-indeno[5,4-f]quinolin-7-one.
| Compound Name | 10-hydroxy-9a,10,11a-trimethyl-1-(2-methyl-1,3-dioxolan-2-yl)-2,3,3a,3b,4,6,8,9,9b,11-decahydro-1H-indeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 145003619 |
| Molecular Formula | C23H35NO4 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.26 |
| IUPAC Name | 10-hydroxy-9a,10,11a-trimethyl-1-(2-methyl-1,3-dioxolan-2-yl)-2,3,3a,3b,4,6,8,9,9b,11-decahydro-1H-indeno[5,4-f]quinolin-7-one |
| SMILES | CC1(O)CC2(C)C(CCC2C2(C)OCCO2)C2CC=C3NC(=O)CCC3(C)C21 |
| InChI | InChI=1S/C23H35NO4/c1-20-10-9-18(25)24-17(20)8-5-14-15-6-7-16(23(4)27-11-12-28-23)21(15,2)13-22(3,26)19(14)20/h8,14-16,19,26H,5-7,9-13H2,1-4H3,(H,24,25) |
| InChIKey | DQQPGXZPQXVZPZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |