C25H39NO4 — CID 169018267
(9aR,10S,11aS)-6-ethyl-10-hydroxy-9a,10,11a-trimethyl-1-(2-methyl-1,3-dioxolan-2-yl)-1,2,3,3a,3b,4,8,9,9b,11-decahydroindeno[5,4-f]quinolin-7-one (PubChem CID 169018267) has the molecular formula C25H39NO4 and a molecular weight of 417.59 g/mol. Its IUPAC name is (9aR,10S,11aS)-6-ethyl-10-hydroxy-9a,10,11a-trimethyl-1-(2-methyl-1,3-dioxolan-2-yl)-1,2,3,3a,3b,4,8,9,9b,11-decahydroindeno[5,4-f]quinolin-7-one.
| Compound Name | (9aR,10S,11aS)-6-ethyl-10-hydroxy-9a,10,11a-trimethyl-1-(2-methyl-1,3-dioxolan-2-yl)-1,2,3,3a,3b,4,8,9,9b,11-decahydroindeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 169018267 |
| Molecular Formula | C25H39NO4 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.29 |
| IUPAC Name | (9aR,10S,11aS)-6-ethyl-10-hydroxy-9a,10,11a-trimethyl-1-(2-methyl-1,3-dioxolan-2-yl)-1,2,3,3a,3b,4,8,9,9b,11-decahydroindeno[5,4-f]quinolin-7-one |
| SMILES | CCN1C(=O)CC[C@@]2(C)C1=CCC1C3CCC(C4(C)OCCO4)[C@@]3(C)CC(C)(O)C12 |
| InChI | InChI=1S/C25H39NO4/c1-6-26-19-10-7-16-17-8-9-18(25(5)29-13-14-30-25)23(17,3)15-24(4,28)21(16)22(19,2)12-11-20(26)27/h10,16-18,21,28H,6-9,11-15H2,1-5H3/t16?,17?,18?,21?,22-,23-,24?/m0/s1 |
| InChIKey | BFFOLKGENVEFAT-XUFIZLDESA-N |
| XLogP | 4.11 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |