C24H39NO3 — CID 170068519
(9aR,10S,11aS)-6-ethyl-10-hydroxy-1-(1-hydroxypropyl)-9a,10,11a-trimethyl-1,2,3,3a,3b,4,8,9,9b,11-decahydroindeno[5,4-f]quinolin-7-one (PubChem CID 170068519) has the molecular formula C24H39NO3 and a molecular weight of 389.58 g/mol. Its IUPAC name is (9aR,10S,11aS)-6-ethyl-10-hydroxy-1-(1-hydroxypropyl)-9a,10,11a-trimethyl-1,2,3,3a,3b,4,8,9,9b,11-decahydroindeno[5,4-f]quinolin-7-one.
| Compound Name | (9aR,10S,11aS)-6-ethyl-10-hydroxy-1-(1-hydroxypropyl)-9a,10,11a-trimethyl-1,2,3,3a,3b,4,8,9,9b,11-decahydroindeno[5,4-f]quinolin-7-one |
|---|---|
| PubChem CID | 170068519 |
| Molecular Formula | C24H39NO3 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.29 |
| IUPAC Name | (9aR,10S,11aS)-6-ethyl-10-hydroxy-1-(1-hydroxypropyl)-9a,10,11a-trimethyl-1,2,3,3a,3b,4,8,9,9b,11-decahydroindeno[5,4-f]quinolin-7-one |
| SMILES | CCC(O)C1CCC2C3CC=C4N(CC)C(=O)CC[C@]4(C)C3C(C)(O)C[C@]12C |
| InChI | InChI=1S/C24H39NO3/c1-6-18(26)17-10-9-16-15-8-11-19-22(3,13-12-20(27)25(19)7-2)21(15)24(5,28)14-23(16,17)4/h11,15-18,21,26,28H,6-10,12-14H2,1-5H3/t15?,16?,17?,18?,21?,22-,23-,24?/m0/s1 |
| InChIKey | BYJZXAWOGVPCAF-NMBAVCGOSA-N |
| XLogP | 4.11 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |