C23H34O3 — CID 118597491
(10R,13S,17S)-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)-1,2,3,4,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-11-one (PubChem CID 118597491) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is (10R,13S,17S)-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)-1,2,3,4,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-11-one.
| Compound Name | (10R,13S,17S)-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)-1,2,3,4,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-11-one |
|---|---|
| PubChem CID | 118597491 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | (10R,13S,17S)-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)-1,2,3,4,7,8,9,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-11-one |
| SMILES | CC1([C@H]2CCC3C4CC=C5CCCC[C@]5(C)C4C(=O)C[C@@]32C)OCCO1 |
| InChI | InChI=1S/C23H34O3/c1-21-11-5-4-6-15(21)7-8-16-17-9-10-19(23(3)25-12-13-26-23)22(17,2)14-18(24)20(16)21/h7,16-17,19-20H,4-6,8-14H2,1-3H3/t16?,17?,19-,20?,21-,22-/m0/s1 |
| InChIKey | CVKYDIKXIMDWGE-XDCAONCZSA-N |
| XLogP | 4.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|