C24H34O4 — CID 90316928
(1'S,4'S,5'R,13'S,14'S,17'S)-5'-methylspiro[1,3-dioxolane-2,8'-18-oxapentacyclo[12.8.0.01,17.04,13.05,10]docos-10-ene]-3'-one (PubChem CID 90316928) has the molecular formula C24H34O4 and a molecular weight of 386.53 g/mol. Its IUPAC name is (1'S,4'S,5'R,13'S,14'S,17'S)-5'-methylspiro[1,3-dioxolane-2,8'-18-oxapentacyclo[12.8.0.01,17.04,13.05,10]docos-10-ene]-3'-one.
| Compound Name | (1'S,4'S,5'R,13'S,14'S,17'S)-5'-methylspiro[1,3-dioxolane-2,8'-18-oxapentacyclo[12.8.0.01,17.04,13.05,10]docos-10-ene]-3'-one |
|---|---|
| PubChem CID | 90316928 |
| Molecular Formula | C24H34O4 |
| Molecular Weight | 386.53 g/mol |
| Exact Mass | 386.25 |
| IUPAC Name | (1'S,4'S,5'R,13'S,14'S,17'S)-5'-methylspiro[1,3-dioxolane-2,8'-18-oxapentacyclo[12.8.0.01,17.04,13.05,10]docos-10-ene]-3'-one |
| SMILES | C[C@]12CCC3(CC1=CC[C@H]1[C@@H]4CC[C@@H]5OCCCC[C@@]54CC(=O)[C@@H]12)OCCO3 |
| InChI | InChI=1S/C24H34O4/c1-22-9-10-24(27-12-13-28-24)14-16(22)4-5-17-18-6-7-20-23(18,8-2-3-11-26-20)15-19(25)21(17)22/h4,17-18,20-21H,2-3,5-15H2,1H3/t17-,18-,20-,21+,22-,23-/m0/s1 |
| InChIKey | PROJFEIUMNMSRM-VDCZKJETSA-N |
| XLogP | 4.42 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|