C26H38O6 — CID 22817707
2-[(8S,9S,10R,11S,13R,14S,17S)-11-hydroxy-10-methyl-17-(2-methyl-1,3-dioxolan-2-yl)spiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-13-yl]acetaldehyde (PubChem CID 22817707) has the molecular formula C26H38O6 and a molecular weight of 446.58 g/mol. Its IUPAC name is 2-[(8S,9S,10R,11S,13R,14S,17S)-11-hydroxy-10-methyl-17-(2-methyl-1,3-dioxolan-2-yl)spiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-13-yl]acetaldehyde.
| Compound Name | 2-[(8S,9S,10R,11S,13R,14S,17S)-11-hydroxy-10-methyl-17-(2-methyl-1,3-dioxolan-2-yl)spiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-13-yl]acetaldehyde |
|---|---|
| PubChem CID | 22817707 |
| Molecular Formula | C26H38O6 |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 2-[(8S,9S,10R,11S,13R,14S,17S)-11-hydroxy-10-methyl-17-(2-methyl-1,3-dioxolan-2-yl)spiro[1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,2'-1,3-dioxolane]-13-yl]acetaldehyde |
| SMILES | CC1([C@H]2CC[C@H]3[C@@H]4CC=C5CC6(CC[C@]5(C)[C@H]4[C@@H](O)C[C@]23CC=O)OCCO6)OCCO1 |
| InChI | InChI=1S/C26H38O6/c1-23-7-8-26(31-13-14-32-26)15-17(23)3-4-18-19-5-6-21(24(2)29-11-12-30-24)25(19,9-10-27)16-20(28)22(18)23/h3,10,18-22,28H,4-9,11-16H2,1-2H3/t18-,19-,20-,21+,22+,23-,25-/m0/s1 |
| InChIKey | PFZFTDOWUXRKSO-NDIMTLHXSA-N |
| XLogP | 3.61 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|