C23H36O4 — CID 158181907
(3S,10R,13S,17S)-3-deuterio-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,11-diol (PubChem CID 158181907) has the molecular formula C23H36O4 and a molecular weight of 377.54 g/mol. Its IUPAC name is (3S,10R,13S,17S)-3-deuterio-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,11-diol.
| Compound Name | (3S,10R,13S,17S)-3-deuterio-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,11-diol |
|---|---|
| PubChem CID | 158181907 |
| Molecular Formula | C23H36O4 |
| Molecular Weight | 377.54 g/mol |
| Exact Mass | 377.27 |
| IUPAC Name | (3S,10R,13S,17S)-3-deuterio-10,13-dimethyl-17-(2-methyl-1,3-dioxolan-2-yl)-1,2,4,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene-3,11-diol |
| SMILES | [2H][C@]1(O)CC[C@@]2(C)C(=CCC3C2C(O)C[C@@]2(C)C3CC[C@@H]2C2(C)OCCO2)C1 |
| InChI | InChI=1S/C23H36O4/c1-21-9-8-15(24)12-14(21)4-5-16-17-6-7-19(23(3)26-10-11-27-23)22(17,2)13-18(25)20(16)21/h4,15-20,24-25H,5-13H2,1-3H3/t15-,16?,17?,18?,19-,20?,21-,22-/m0/s1/i15D |
| InChIKey | NYMJUOIQKBXNPW-RISAIWHJSA-N |
| XLogP | 3.66 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|