C50H32Br4 — CID 156698229
1-bromo-3-[4-[1,2,2-tris[4-(3-bromophenyl)phenyl]ethenyl]phenyl]benzene (PubChem CID 156698229) has the molecular formula C50H32Br4 and a molecular weight of 952.42 g/mol. Its IUPAC name is 1-bromo-3-[4-[1,2,2-tris[4-(3-bromophenyl)phenyl]ethenyl]phenyl]benzene.
| Compound Name | 1-bromo-3-[4-[1,2,2-tris[4-(3-bromophenyl)phenyl]ethenyl]phenyl]benzene |
|---|---|
| PubChem CID | 156698229 |
| Molecular Formula | C50H32Br4 |
| Molecular Weight | 952.42 g/mol |
| Exact Mass | 947.92 |
| IUPAC Name | 1-bromo-3-[4-[1,2,2-tris[4-(3-bromophenyl)phenyl]ethenyl]phenyl]benzene |
| SMILES | Brc1cccc(-c2ccc(C(=C(c3ccc(-c4cccc(Br)c4)cc3)c3ccc(-c4cccc(Br)c4)cc3)c3ccc(-c4cccc(Br)c4)cc3)cc2)c1 |
| InChI | InChI=1S/C50H32Br4/c51-45-9-1-5-41(29-45)33-13-21-37(22-14-33)49(38-23-15-34(16-24-38)42-6-2-10-46(52)30-42)50(39-25-17-35(18-26-39)43-7-3-11-47(53)31-43)40-27-19-36(20-28-40)44-8-4-12-48(54)32-44/h1-32H |
| InChIKey | ZIIXXJDETRWRKY-UHFFFAOYSA-N |
| XLogP | 16.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 952.42 |
| LogP ≤ 5 | 16.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|