C22H24ClFN6O3 — CID 156698722
(1-methyl-1,2,4-triazol-3-yl) N-[1-[(3-chloro-4-fluorophenyl)carbamoyl]-2-methyl-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-yl]-N-methylcarbamate (PubChem CID 156698722) has the molecular formula C22H24ClFN6O3 and a molecular weight of 474.92 g/mol. Its IUPAC name is (1-methyl-1,2,4-triazol-3-yl) N-[1-[(3-chloro-4-fluorophenyl)carbamoyl]-2-methyl-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-yl]-N-methylcarbamate.
| Compound Name | (1-methyl-1,2,4-triazol-3-yl) N-[1-[(3-chloro-4-fluorophenyl)carbamoyl]-2-methyl-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-yl]-N-methylcarbamate |
|---|---|
| PubChem CID | 156698722 |
| Molecular Formula | C22H24ClFN6O3 |
| Molecular Weight | 474.92 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | (1-methyl-1,2,4-triazol-3-yl) N-[1-[(3-chloro-4-fluorophenyl)carbamoyl]-2-methyl-5,6,7,8-tetrahydro-4H-cyclohepta[c]pyrrol-4-yl]-N-methylcarbamate |
| SMILES | CN(C(=O)Oc1ncn(C)n1)C1CCCCc2c1cn(C)c2C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C22H24ClFN6O3/c1-28-11-15-14(19(28)20(31)26-13-8-9-17(24)16(23)10-13)6-4-5-7-18(15)30(3)22(32)33-21-25-12-29(2)27-21/h8-12,18H,4-7H2,1-3H3,(H,26,31) |
| InChIKey | WDBCEEFBZWXLHO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 94.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.92 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |