C19H20ClF2N3O2 — CID 156897786
N-(3-chloro-4-fluorophenyl)-5-(5-fluoro-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl)-3-methylimidazole-4-carboxamide (PubChem CID 156897786) has the molecular formula C19H20ClF2N3O2 and a molecular weight of 395.84 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-5-(5-fluoro-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl)-3-methylimidazole-4-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-5-(5-fluoro-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl)-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 156897786 |
| Molecular Formula | C19H20ClF2N3O2 |
| Molecular Weight | 395.84 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-5-(5-fluoro-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl)-3-methylimidazole-4-carboxamide |
| SMILES | Cn1cnc(C2CC3CC(O)(F)CC3C2)c1C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C19H20ClF2N3O2/c1-25-9-23-16(10-4-11-7-19(22,27)8-12(11)5-10)17(25)18(26)24-13-2-3-15(21)14(20)6-13/h2-3,6,9-12,27H,4-5,7-8H2,1H3,(H,24,26) |
| InChIKey | ZMVCKMOZRKJRKJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.84 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |