C23H23ClF2IN5O2 — CID 167524032
N-(3-chloro-4-fluorophenyl)-5-[5-(4-fluoro-3-iodo-1-methylpyrazol-5-yl)-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-3-methylimidazole-4-carboxamide (PubChem CID 167524032) has the molecular formula C23H23ClF2IN5O2 and a molecular weight of 601.82 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-5-[5-(4-fluoro-3-iodo-1-methylpyrazol-5-yl)-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-3-methylimidazole-4-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-5-[5-(4-fluoro-3-iodo-1-methylpyrazol-5-yl)-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 167524032 |
| Molecular Formula | C23H23ClF2IN5O2 |
| Molecular Weight | 601.82 g/mol |
| Exact Mass | 601.06 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-5-[5-(4-fluoro-3-iodo-1-methylpyrazol-5-yl)-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-3-methylimidazole-4-carboxamide |
| SMILES | Cn1cnc(C2CC3CC(O)(c4c(F)c(I)nn4C)CC3C2)c1C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C23H23ClF2IN5O2/c1-31-10-28-18(19(31)22(33)29-14-3-4-16(25)15(24)7-14)11-5-12-8-23(34,9-13(12)6-11)20-17(26)21(27)30-32(20)2/h3-4,7,10-13,34H,5-6,8-9H2,1-2H3,(H,29,33) |
| InChIKey | IZFKEUJNLMZHNV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.82 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|