C19H22ClFN4O3S — CID 170262080
N-(3-chloro-4-fluorophenyl)-3-methyl-5-(5-sulfamoyl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)imidazole-4-carboxamide (PubChem CID 170262080) has the molecular formula C19H22ClFN4O3S and a molecular weight of 440.93 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-3-methyl-5-(5-sulfamoyl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)imidazole-4-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-3-methyl-5-(5-sulfamoyl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 170262080 |
| Molecular Formula | C19H22ClFN4O3S |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-3-methyl-5-(5-sulfamoyl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)imidazole-4-carboxamide |
| SMILES | Cn1cnc(C2CC3CC(S(N)(=O)=O)CC3C2)c1C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C19H22ClFN4O3S/c1-25-9-23-17(12-4-10-6-14(29(22,27)28)7-11(10)5-12)18(25)19(26)24-13-2-3-16(21)15(20)8-13/h2-3,8-12,14H,4-7H2,1H3,(H,24,26)(H2,22,27,28) |
| InChIKey | LJHHEWTVILQEMN-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |