C25H27ClFN3O4 — CID 170256141
N-(3-chloro-4-fluorophenyl)-5-[5-hydroxy-5-[2-(3-hydroxyoxolan-3-yl)ethynyl]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-3-methylimidazole-4-carboxamide (PubChem CID 170256141) has the molecular formula C25H27ClFN3O4 and a molecular weight of 487.96 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-5-[5-hydroxy-5-[2-(3-hydroxyoxolan-3-yl)ethynyl]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-3-methylimidazole-4-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-5-[5-hydroxy-5-[2-(3-hydroxyoxolan-3-yl)ethynyl]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 170256141 |
| Molecular Formula | C25H27ClFN3O4 |
| Molecular Weight | 487.96 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-5-[5-hydroxy-5-[2-(3-hydroxyoxolan-3-yl)ethynyl]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-3-methylimidazole-4-carboxamide |
| SMILES | Cn1cnc(C2CC3CC(O)(C#CC4(O)CCOC4)CC3C2)c1C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C25H27ClFN3O4/c1-30-14-28-21(22(30)23(31)29-18-2-3-20(27)19(26)10-18)15-8-16-11-25(33,12-17(16)9-15)5-4-24(32)6-7-34-13-24/h2-3,10,14-17,32-33H,6-9,11-13H2,1H3,(H,29,31) |
| InChIKey | DFYWSYIOYQYPPE-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.96 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|