C26H25ClF3N5O2 — CID 170256327
N-(3-chloro-4-fluorophenyl)-5-[5-[2-[3-(difluoromethyl)-1-methylpyrazol-4-yl]ethynyl]-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-3-methylimidazole-4-carboxamide (PubChem CID 170256327) has the molecular formula C26H25ClF3N5O2 and a molecular weight of 531.97 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-5-[5-[2-[3-(difluoromethyl)-1-methylpyrazol-4-yl]ethynyl]-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-3-methylimidazole-4-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-5-[5-[2-[3-(difluoromethyl)-1-methylpyrazol-4-yl]ethynyl]-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 170256327 |
| Molecular Formula | C26H25ClF3N5O2 |
| Molecular Weight | 531.97 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-5-[5-[2-[3-(difluoromethyl)-1-methylpyrazol-4-yl]ethynyl]-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-3-methylimidazole-4-carboxamide |
| SMILES | Cn1cc(C#CC2(O)CC3CC(c4ncn(C)c4C(=O)Nc4ccc(F)c(Cl)c4)CC3C2)c(C(F)F)n1 |
| InChI | InChI=1S/C26H25ClF3N5O2/c1-34-13-31-21(23(34)25(36)32-18-3-4-20(28)19(27)9-18)15-7-16-10-26(37,11-17(16)8-15)6-5-14-12-35(2)33-22(14)24(29)30/h3-4,9,12-13,15-17,24,37H,7-8,10-11H2,1-2H3,(H,32,36) |
| InChIKey | QHXXPEGIIPYRKN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 84.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.97 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|