C28H29ClFN5O3 — CID 170257155
N-(3-chloro-4-fluorophenyl)-5-[5-hydroxy-5-[2-[2-(2-hydroxypropan-2-yl)pyrimidin-5-yl]ethynyl]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-3-methylimidazole-4-carboxamide (PubChem CID 170257155) has the molecular formula C28H29ClFN5O3 and a molecular weight of 538.02 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-5-[5-hydroxy-5-[2-[2-(2-hydroxypropan-2-yl)pyrimidin-5-yl]ethynyl]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-3-methylimidazole-4-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-5-[5-hydroxy-5-[2-[2-(2-hydroxypropan-2-yl)pyrimidin-5-yl]ethynyl]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 170257155 |
| Molecular Formula | C28H29ClFN5O3 |
| Molecular Weight | 538.02 g/mol |
| Exact Mass | 537.19 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-5-[5-hydroxy-5-[2-[2-(2-hydroxypropan-2-yl)pyrimidin-5-yl]ethynyl]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-3-methylimidazole-4-carboxamide |
| SMILES | Cn1cnc(C2CC3CC(O)(C#Cc4cnc(C(C)(C)O)nc4)CC3C2)c1C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C28H29ClFN5O3/c1-27(2,37)26-31-13-16(14-32-26)6-7-28(38)11-18-8-17(9-19(18)12-28)23-24(35(3)15-33-23)25(36)34-20-4-5-22(30)21(29)10-20/h4-5,10,13-15,17-19,37-38H,8-9,11-12H2,1-3H3,(H,34,36) |
| InChIKey | SYLJECAESRWNRR-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.02 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|