C27H25ClF4N4O3S — CID 170256361
N-(3-chloro-4-fluorophenyl)-5-[5-hydroxy-5-[3-hydroxy-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]but-1-ynyl]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-3-methylimidazole-4-carboxamide (PubChem CID 170256361) has the molecular formula C27H25ClF4N4O3S and a molecular weight of 597.03 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-5-[5-hydroxy-5-[3-hydroxy-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]but-1-ynyl]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-3-methylimidazole-4-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-5-[5-hydroxy-5-[3-hydroxy-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]but-1-ynyl]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 170256361 |
| Molecular Formula | C27H25ClF4N4O3S |
| Molecular Weight | 597.03 g/mol |
| Exact Mass | 596.13 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-5-[5-hydroxy-5-[3-hydroxy-3-[4-(trifluoromethyl)-1,3-thiazol-2-yl]but-1-ynyl]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-3-methylimidazole-4-carboxamide |
| SMILES | Cn1cnc(C2CC3CC(O)(C#CC(C)(O)c4nc(C(F)(F)F)cs4)CC3C2)c1C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C27H25ClF4N4O3S/c1-25(38,24-35-20(12-40-24)27(30,31)32)5-6-26(39)10-15-7-14(8-16(15)11-26)21-22(36(2)13-33-21)23(37)34-17-3-4-19(29)18(28)9-17/h3-4,9,12-16,38-39H,7-8,10-11H2,1-2H3,(H,34,37) |
| InChIKey | VHCZYDKQIPXYFY-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.03 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|