C24H28ClFN4O2 — CID 170256139
5-[5-(3-amino-3-methylbut-1-ynyl)-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-N-(3-chloro-4-fluorophenyl)-3-methylimidazole-4-carboxamide (PubChem CID 170256139) has the molecular formula C24H28ClFN4O2 and a molecular weight of 458.97 g/mol. Its IUPAC name is 5-[5-(3-amino-3-methylbut-1-ynyl)-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-N-(3-chloro-4-fluorophenyl)-3-methylimidazole-4-carboxamide.
| Compound Name | 5-[5-(3-amino-3-methylbut-1-ynyl)-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-N-(3-chloro-4-fluorophenyl)-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 170256139 |
| Molecular Formula | C24H28ClFN4O2 |
| Molecular Weight | 458.97 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 5-[5-(3-amino-3-methylbut-1-ynyl)-5-hydroxy-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl]-N-(3-chloro-4-fluorophenyl)-3-methylimidazole-4-carboxamide |
| SMILES | Cn1cnc(C2CC3CC(O)(C#CC(C)(C)N)CC3C2)c1C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C24H28ClFN4O2/c1-23(2,27)6-7-24(32)11-15-8-14(9-16(15)12-24)20-21(30(3)13-28-20)22(31)29-17-4-5-19(26)18(25)10-17/h4-5,10,13-16,32H,8-9,11-12,27H2,1-3H3,(H,29,31) |
| InChIKey | FBFFDYWDADCPNI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.97 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|