C20H23ClFN3O2 — CID 166825988
N-(3-chloro-4-fluorophenyl)-5-(5-hydroxy-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl)-3-methylimidazole-4-carboxamide (PubChem CID 166825988) has the molecular formula C20H23ClFN3O2 and a molecular weight of 391.87 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-5-(5-hydroxy-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl)-3-methylimidazole-4-carboxamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-5-(5-hydroxy-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl)-3-methylimidazole-4-carboxamide |
|---|---|
| PubChem CID | 166825988 |
| Molecular Formula | C20H23ClFN3O2 |
| Molecular Weight | 391.87 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-5-(5-hydroxy-5-methyl-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-yl)-3-methylimidazole-4-carboxamide |
| SMILES | Cn1cnc(C2CC3CC(C)(O)CC3C2)c1C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C20H23ClFN3O2/c1-20(27)8-12-5-11(6-13(12)9-20)17-18(25(2)10-23-17)19(26)24-14-3-4-16(22)15(21)7-14/h3-4,7,10-13,27H,5-6,8-9H2,1-2H3,(H,24,26) |
| InChIKey | VONFJXHVKJOOJR-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.87 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |