C8H5ClF6N2 — CID 156702121
[4-chloro-2,5-bis(trifluoromethyl)phenyl]hydrazine (PubChem CID 156702121) has the molecular formula C8H5ClF6N2 and a molecular weight of 278.58 g/mol. Its IUPAC name is [4-chloro-2,5-bis(trifluoromethyl)phenyl]hydrazine.
| Compound Name | [4-chloro-2,5-bis(trifluoromethyl)phenyl]hydrazine |
|---|---|
| PubChem CID | 156702121 |
| Molecular Formula | C8H5ClF6N2 |
| Molecular Weight | 278.58 g/mol |
| Exact Mass | 278.00 |
| IUPAC Name | [4-chloro-2,5-bis(trifluoromethyl)phenyl]hydrazine |
| SMILES | NNc1cc(C(F)(F)F)c(Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C8H5ClF6N2/c9-5-1-4(8(13,14)15)6(17-16)2-3(5)7(10,11)12/h1-2,17H,16H2 |
| InChIKey | LNXQJPYVYXRUJW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.58 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|