C7H5Cl2F3N2 — CID 154931725
[3,5-dichloro-4-(trifluoromethyl)phenyl]hydrazine (PubChem CID 154931725) has the molecular formula C7H5Cl2F3N2 and a molecular weight of 245.03 g/mol. Its IUPAC name is [3,5-dichloro-4-(trifluoromethyl)phenyl]hydrazine.
| Compound Name | [3,5-dichloro-4-(trifluoromethyl)phenyl]hydrazine |
|---|---|
| PubChem CID | 154931725 |
| Molecular Formula | C7H5Cl2F3N2 |
| Molecular Weight | 245.03 g/mol |
| Exact Mass | 243.98 |
| IUPAC Name | [3,5-dichloro-4-(trifluoromethyl)phenyl]hydrazine |
| SMILES | NNc1cc(Cl)c(C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C7H5Cl2F3N2/c8-4-1-3(14-13)2-5(9)6(4)7(10,11)12/h1-2,14H,13H2 |
| InChIKey | DFZNKPMYMUTFBC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.03 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|