C9H4Cl3F3O — CID 171030311
2-chloro-1-[3,5-dichloro-4-(trifluoromethyl)phenyl]ethanone (PubChem CID 171030311) has the molecular formula C9H4Cl3F3O and a molecular weight of 291.48 g/mol. Its IUPAC name is 2-chloro-1-[3,5-dichloro-4-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 2-chloro-1-[3,5-dichloro-4-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 171030311 |
| Molecular Formula | C9H4Cl3F3O |
| Molecular Weight | 291.48 g/mol |
| Exact Mass | 289.93 |
| IUPAC Name | 2-chloro-1-[3,5-dichloro-4-(trifluoromethyl)phenyl]ethanone |
| SMILES | O=C(CCl)c1cc(Cl)c(C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C9H4Cl3F3O/c10-3-7(16)4-1-5(11)8(6(12)2-4)9(13,14)15/h1-2H,3H2 |
| InChIKey | XMLLKUBLGXNEQS-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|