C12H12Cl2N2O3 — CID 156702235
3,4-dichloro-N-(1-cyano-2-ethylperoxyethyl)benzamide (PubChem CID 156702235) has the molecular formula C12H12Cl2N2O3 and a molecular weight of 303.15 g/mol. Its IUPAC name is 3,4-dichloro-N-(1-cyano-2-ethylperoxyethyl)benzamide.
| Compound Name | 3,4-dichloro-N-(1-cyano-2-ethylperoxyethyl)benzamide |
|---|---|
| PubChem CID | 156702235 |
| Molecular Formula | C12H12Cl2N2O3 |
| Molecular Weight | 303.15 g/mol |
| Exact Mass | 302.02 |
| IUPAC Name | 3,4-dichloro-N-(1-cyano-2-ethylperoxyethyl)benzamide |
| SMILES | CCOOCC(C#N)NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H12Cl2N2O3/c1-2-18-19-7-9(6-15)16-12(17)8-3-4-10(13)11(14)5-8/h3-5,9H,2,7H2,1H3,(H,16,17) |
| InChIKey | NXIADLBKMLTVDU-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 71.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.15 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|