C24H29N3O5S — CID 15670281
dimethylcarbamoyl 3-[[2-benzyl-3-(dimethylcarbamoylsulfanyl)propanoyl]amino]-2-methylbenzoate (PubChem CID 15670281) has the molecular formula C24H29N3O5S and a molecular weight of 471.58 g/mol. Its IUPAC name is dimethylcarbamoyl 3-[[2-benzyl-3-(dimethylcarbamoylsulfanyl)propanoyl]amino]-2-methylbenzoate.
| Compound Name | dimethylcarbamoyl 3-[[2-benzyl-3-(dimethylcarbamoylsulfanyl)propanoyl]amino]-2-methylbenzoate |
|---|---|
| PubChem CID | 15670281 |
| Molecular Formula | C24H29N3O5S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.18 |
| IUPAC Name | dimethylcarbamoyl 3-[[2-benzyl-3-(dimethylcarbamoylsulfanyl)propanoyl]amino]-2-methylbenzoate |
| SMILES | Cc1c(NC(=O)C(CSC(=O)N(C)C)Cc2ccccc2)cccc1C(=O)OC(=O)N(C)C |
| InChI | InChI=1S/C24H29N3O5S/c1-16-19(22(29)32-23(30)26(2)3)12-9-13-20(16)25-21(28)18(15-33-24(31)27(4)5)14-17-10-7-6-8-11-17/h6-13,18H,14-15H2,1-5H3,(H,25,28) |
| InChIKey | GXEGSXWXFCADFE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|