C26H26N2O3S — CID 156703131
N-[(4-ethylsulfonylphenyl)methyl]-1-[(2-methylphenyl)methyl]indole-5-carboxamide (PubChem CID 156703131) has the molecular formula C26H26N2O3S and a molecular weight of 446.57 g/mol. Its IUPAC name is N-[(4-ethylsulfonylphenyl)methyl]-1-[(2-methylphenyl)methyl]indole-5-carboxamide.
| Compound Name | N-[(4-ethylsulfonylphenyl)methyl]-1-[(2-methylphenyl)methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 156703131 |
| Molecular Formula | C26H26N2O3S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | N-[(4-ethylsulfonylphenyl)methyl]-1-[(2-methylphenyl)methyl]indole-5-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(CNC(=O)c2ccc3c(ccn3Cc3ccccc3C)c2)cc1 |
| InChI | InChI=1S/C26H26N2O3S/c1-3-32(30,31)24-11-8-20(9-12-24)17-27-26(29)22-10-13-25-21(16-22)14-15-28(25)18-23-7-5-4-6-19(23)2/h4-16H,3,17-18H2,1-2H3,(H,27,29) |
| InChIKey | MJHTYECBJMMBBW-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |