C56H60N4O8S2 — CID 175128934
N-[(4-ethylsulfonylphenyl)methyl]-1-[(2-propan-2-yloxyphenyl)methyl]indole-5-carboxamide (PubChem CID 175128934) has the molecular formula C56H60N4O8S2 and a molecular weight of 981.25 g/mol. Its IUPAC name is N-[(4-ethylsulfonylphenyl)methyl]-1-[(2-propan-2-yloxyphenyl)methyl]indole-5-carboxamide.
| Compound Name | N-[(4-ethylsulfonylphenyl)methyl]-1-[(2-propan-2-yloxyphenyl)methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 175128934 |
| Molecular Formula | C56H60N4O8S2 |
| Molecular Weight | 981.25 g/mol |
| Exact Mass | 980.39 |
| IUPAC Name | N-[(4-ethylsulfonylphenyl)methyl]-1-[(2-propan-2-yloxyphenyl)methyl]indole-5-carboxamide |
| SMILES | CCS(=O)(=O)c1ccc(CNC(=O)c2ccc3c(ccn3Cc3ccccc3OC(C)C)c2)cc1.CCS(=O)(=O)c1ccc(CNC(=O)c2ccc3c(ccn3Cc3ccccc3OC(C)C)c2)cc1 |
| InChI | InChI=1S/2C28H30N2O4S/c2*1-4-35(32,33)25-12-9-21(10-13-25)18-29-28(31)23-11-14-26-22(17-23)15-16-30(26)19-24-7-5-6-8-27(24)34-20(2)3/h2*5-17,20H,4,18-19H2,1-3H3,(H,29,31) |
| InChIKey | JHNAGIRVXUCPFR-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 154.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 981.25 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |