C22H21FN6O2S — CID 156704054
N-(5-fluoro-2-pyridinyl)-2-[12-methyl-8-oxo-5-(thian-4-yl)-2,6,7,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10,12-pentaen-2-yl]acetamide (PubChem CID 156704054) has the molecular formula C22H21FN6O2S and a molecular weight of 452.52 g/mol. Its IUPAC name is N-(5-fluoro-2-pyridinyl)-2-[12-methyl-8-oxo-5-(thian-4-yl)-2,6,7,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10,12-pentaen-2-yl]acetamide.
| Compound Name | N-(5-fluoro-2-pyridinyl)-2-[12-methyl-8-oxo-5-(thian-4-yl)-2,6,7,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10,12-pentaen-2-yl]acetamide |
|---|---|
| PubChem CID | 156704054 |
| Molecular Formula | C22H21FN6O2S |
| Molecular Weight | 452.52 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | N-(5-fluoro-2-pyridinyl)-2-[12-methyl-8-oxo-5-(thian-4-yl)-2,6,7,13-tetrazatricyclo[7.4.0.03,7]trideca-1(9),3,5,10,12-pentaen-2-yl]acetamide |
| SMILES | Cc1ccc2c(=O)n3nc(C4CCSCC4)cc3n(CC(=O)Nc3ccc(F)cn3)c2n1 |
| InChI | InChI=1S/C22H21FN6O2S/c1-13-2-4-16-21(25-13)28(12-19(30)26-18-5-3-15(23)11-24-18)20-10-17(27-29(20)22(16)31)14-6-8-32-9-7-14/h2-5,10-11,14H,6-9,12H2,1H3,(H,24,26,30) |
| InChIKey | KUOGFYNIQFITHT-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.52 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |