C21H17Cl2N3O3 — CID 156704863
N-(3-chlorophenyl)-4-[(2S)-1-[(6-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl]oxybenzamide (PubChem CID 156704863) has the molecular formula C21H17Cl2N3O3 and a molecular weight of 430.29 g/mol. Its IUPAC name is N-(3-chlorophenyl)-4-[(2S)-1-[(6-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl]oxybenzamide.
| Compound Name | N-(3-chlorophenyl)-4-[(2S)-1-[(6-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl]oxybenzamide |
|---|---|
| PubChem CID | 156704863 |
| Molecular Formula | C21H17Cl2N3O3 |
| Molecular Weight | 430.29 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | N-(3-chlorophenyl)-4-[(2S)-1-[(6-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl]oxybenzamide |
| SMILES | C[C@H](Oc1ccc(C(=O)Nc2cccc(Cl)c2)cc1)C(=O)Nc1ccc(Cl)nc1 |
| InChI | InChI=1S/C21H17Cl2N3O3/c1-13(20(27)26-17-7-10-19(23)24-12-17)29-18-8-5-14(6-9-18)21(28)25-16-4-2-3-15(22)11-16/h2-13H,1H3,(H,25,28)(H,26,27)/t13-/m0/s1 |
| InChIKey | RHBBVTIBFOCXLE-ZDUSSCGKSA-N |
| XLogP | 5.05 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.29 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|