C30H29N3O7 — CID 156705085
2-methoxyethoxymethyl 5-[[3-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)-4-pyridinyl]oxy]-1-benzofuran-3-carboxylate (PubChem CID 156705085) has the molecular formula C30H29N3O7 and a molecular weight of 543.58 g/mol. Its IUPAC name is 2-methoxyethoxymethyl 5-[[3-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)-4-pyridinyl]oxy]-1-benzofuran-3-carboxylate.
| Compound Name | 2-methoxyethoxymethyl 5-[[3-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)-4-pyridinyl]oxy]-1-benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 156705085 |
| Molecular Formula | C30H29N3O7 |
| Molecular Weight | 543.58 g/mol |
| Exact Mass | 543.20 |
| IUPAC Name | 2-methoxyethoxymethyl 5-[[3-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)-4-pyridinyl]oxy]-1-benzofuran-3-carboxylate |
| SMILES | COCCOCOC(=O)c1coc2ccc(Oc3ccncc3C(=O)N3CCN(C4CC4)c4ccccc43)cc12 |
| InChI | InChI=1S/C30H29N3O7/c1-36-14-15-37-19-39-30(35)24-18-38-27-9-8-21(16-22(24)27)40-28-10-11-31-17-23(28)29(34)33-13-12-32(20-6-7-20)25-4-2-3-5-26(25)33/h2-5,8-11,16-18,20H,6-7,12-15,19H2,1H3 |
| InChIKey | SGVIYGVVOOCNSC-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 103.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.58 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|