C28H29N3O5 — CID 156705107
ethoxymethyl 2-[3-[[3-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)-4-pyridinyl]oxy]phenyl]acetate (PubChem CID 156705107) has the molecular formula C28H29N3O5 and a molecular weight of 487.56 g/mol. Its IUPAC name is ethoxymethyl 2-[3-[[3-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)-4-pyridinyl]oxy]phenyl]acetate.
| Compound Name | ethoxymethyl 2-[3-[[3-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)-4-pyridinyl]oxy]phenyl]acetate |
|---|---|
| PubChem CID | 156705107 |
| Molecular Formula | C28H29N3O5 |
| Molecular Weight | 487.56 g/mol |
| Exact Mass | 487.21 |
| IUPAC Name | ethoxymethyl 2-[3-[[3-(4-cyclopropyl-2,3-dihydroquinoxaline-1-carbonyl)-4-pyridinyl]oxy]phenyl]acetate |
| SMILES | CCOCOC(=O)Cc1cccc(Oc2ccncc2C(=O)N2CCN(C3CC3)c3ccccc32)c1 |
| InChI | InChI=1S/C28H29N3O5/c1-2-34-19-35-27(32)17-20-6-5-7-22(16-20)36-26-12-13-29-18-23(26)28(33)31-15-14-30(21-10-11-21)24-8-3-4-9-25(24)31/h3-9,12-13,16,18,21H,2,10-11,14-15,17,19H2,1H3 |
| InChIKey | ITXBDBGKUNMOPJ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 81.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.56 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|