About ethyl 4-(2-methyl-1,3-dioxol-2-yl)butanoate
ethyl 4-(2-methyl-1,3-dioxol-2-yl)butanoate (PubChem CID 156705209) has the molecular formula C10H16O4
and a molecular weight of 200.23 g/mol. Its IUPAC name is ethyl 4-(2-methyl-1,3-dioxol-2-yl)butanoate.
Molecular Properties
| Compound Name | ethyl 4-(2-methyl-1,3-dioxol-2-yl)butanoate |
| PubChem CID | 156705209 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | ethyl 4-(2-methyl-1,3-dioxol-2-yl)butanoate |
| SMILES | CCOC(=O)CCCC1(C)OC=CO1 |
| InChI | InChI=1S/C10H16O4/c1-3-12-9(11)5-4-6-10(2)13-7-8-14-10/h7-8H,3-6H2,1-2H3 |
| InChIKey | FFYSLJIWPFBREZ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 4-(2-methyl-1,3-dioxol-2-yl)butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(2-methyl-1,3-dioxol-2-yl)butanoate?
The IUPAC name of ethyl 4-(2-methyl-1,3-dioxol-2-yl)butanoate (CID 156705209) is ethyl 4-(2-methyl-1,3-dioxol-2-yl)butanoate.
What is the SMILES notation for ethyl 4-(2-methyl-1,3-dioxol-2-yl)butanoate?
The canonical SMILES for ethyl 4-(2-methyl-1,3-dioxol-2-yl)butanoate is CCOC(=O)CCCC1(C)OC=CO1.
What is the InChIKey of ethyl 4-(2-methyl-1,3-dioxol-2-yl)butanoate?
The InChIKey is FFYSLJIWPFBREZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O4/c1-3-12-9(11)5-4-6-10(2)13-7-8-14-10/h7-8H,3-6H2,1-2H3.
What are the key properties of ethyl 4-(2-methyl-1,3-dioxol-2-yl)butanoate?
ethyl 4-(2-methyl-1,3-dioxol-2-yl)butanoate has a molecular weight of 200.23 g/mol, XLogP of 1.95, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(2-methyl-1,3-dioxol-2-yl)butanoate is sourced from PubChem (CID 156705209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).