C14H23NO5 — CID 15670647
5-[[3-(tert-butylamino)-2-hydroxypropoxy]methyl]benzene-1,2,3-triol (PubChem CID 15670647) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is 5-[[3-(tert-butylamino)-2-hydroxypropoxy]methyl]benzene-1,2,3-triol.
| Compound Name | 5-[[3-(tert-butylamino)-2-hydroxypropoxy]methyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 15670647 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 5-[[3-(tert-butylamino)-2-hydroxypropoxy]methyl]benzene-1,2,3-triol |
| SMILES | CC(C)(C)NCC(O)COCc1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C14H23NO5/c1-14(2,3)15-6-10(16)8-20-7-9-4-11(17)13(19)12(18)5-9/h4-5,10,15-19H,6-8H2,1-3H3 |
| InChIKey | OKLYVGDHVQGUHX-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 102.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|