C17H30O7 — CID 15670773
dimethyl (2R)-2-[(4R)-6,6-dimethoxy-4-propan-2-ylhexanoyl]butanedioate (PubChem CID 15670773) has the molecular formula C17H30O7 and a molecular weight of 346.42 g/mol. Its IUPAC name is dimethyl (2R)-2-[(4R)-6,6-dimethoxy-4-propan-2-ylhexanoyl]butanedioate.
| Compound Name | dimethyl (2R)-2-[(4R)-6,6-dimethoxy-4-propan-2-ylhexanoyl]butanedioate |
|---|---|
| PubChem CID | 15670773 |
| Molecular Formula | C17H30O7 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | dimethyl (2R)-2-[(4R)-6,6-dimethoxy-4-propan-2-ylhexanoyl]butanedioate |
| SMILES | COC(=O)C[C@H](C(=O)CC[C@H](CC(OC)OC)C(C)C)C(=O)OC |
| InChI | InChI=1S/C17H30O7/c1-11(2)12(9-16(22-4)23-5)7-8-14(18)13(17(20)24-6)10-15(19)21-3/h11-13,16H,7-10H2,1-6H3/t12-,13-/m1/s1 |
| InChIKey | RMLUPHWGGYVINI-CHWSQXEVSA-N |
| XLogP | 1.97 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|