C22H26N4O — CID 156708196
4-(1-methylpyrrolidin-3-yl)-N-(3-phenylpropyl)benzimidazole-1-carboxamide (PubChem CID 156708196) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is 4-(1-methylpyrrolidin-3-yl)-N-(3-phenylpropyl)benzimidazole-1-carboxamide.
| Compound Name | 4-(1-methylpyrrolidin-3-yl)-N-(3-phenylpropyl)benzimidazole-1-carboxamide |
|---|---|
| PubChem CID | 156708196 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | 4-(1-methylpyrrolidin-3-yl)-N-(3-phenylpropyl)benzimidazole-1-carboxamide |
| SMILES | CN1CCC(c2cccc3c2ncn3C(=O)NCCCc2ccccc2)C1 |
| InChI | InChI=1S/C22H26N4O/c1-25-14-12-18(15-25)19-10-5-11-20-21(19)24-16-26(20)22(27)23-13-6-9-17-7-3-2-4-8-17/h2-5,7-8,10-11,16,18H,6,9,12-15H2,1H3,(H,23,27) |
| InChIKey | HJEGNSRFIAJZQX-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|