C25H32N4O2 — CID 175826583
2-methoxy-4-(1-methylpiperidin-4-yl)-N-(4-phenylbutyl)benzimidazole-1-carboxamide (PubChem CID 175826583) has the molecular formula C25H32N4O2 and a molecular weight of 420.56 g/mol. Its IUPAC name is 2-methoxy-4-(1-methylpiperidin-4-yl)-N-(4-phenylbutyl)benzimidazole-1-carboxamide.
| Compound Name | 2-methoxy-4-(1-methylpiperidin-4-yl)-N-(4-phenylbutyl)benzimidazole-1-carboxamide |
|---|---|
| PubChem CID | 175826583 |
| Molecular Formula | C25H32N4O2 |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 2-methoxy-4-(1-methylpiperidin-4-yl)-N-(4-phenylbutyl)benzimidazole-1-carboxamide |
| SMILES | COc1nc2c(C3CCN(C)CC3)cccc2n1C(=O)NCCCCc1ccccc1 |
| InChI | InChI=1S/C25H32N4O2/c1-28-17-14-20(15-18-28)21-12-8-13-22-23(21)27-25(31-2)29(22)24(30)26-16-7-6-11-19-9-4-3-5-10-19/h3-5,8-10,12-13,20H,6-7,11,14-18H2,1-2H3,(H,26,30) |
| InChIKey | VEXDPXXVSJGHAR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|