C24H30F2N8O3S2 — CID 156709379
(2,2-difluoroethanimidoyl) 6-[(1-cyanocyclopropyl)sulfamoyl]-4-[3-methyl-4-(2-methylbutanoyl)piperazin-1-yl]indazole-1-carboximidothioate (PubChem CID 156709379) has the molecular formula C24H30F2N8O3S2 and a molecular weight of 580.69 g/mol. Its IUPAC name is (2,2-difluoroethanimidoyl) 6-[(1-cyanocyclopropyl)sulfamoyl]-4-[3-methyl-4-(2-methylbutanoyl)piperazin-1-yl]indazole-1-carboximidothioate.
| Compound Name | (2,2-difluoroethanimidoyl) 6-[(1-cyanocyclopropyl)sulfamoyl]-4-[3-methyl-4-(2-methylbutanoyl)piperazin-1-yl]indazole-1-carboximidothioate |
|---|---|
| PubChem CID | 156709379 |
| Molecular Formula | C24H30F2N8O3S2 |
| Molecular Weight | 580.69 g/mol |
| Exact Mass | 580.19 |
| IUPAC Name | (2,2-difluoroethanimidoyl) 6-[(1-cyanocyclopropyl)sulfamoyl]-4-[3-methyl-4-(2-methylbutanoyl)piperazin-1-yl]indazole-1-carboximidothioate |
| SMILES | [H]/N=C(\S/C(=N/[H])C(F)F)n1ncc2c(N3CCN(C(=O)C(C)CC)C(C)C3)cc(S(=O)(=O)NC3(C#N)CC3)cc21 |
| InChI | InChI=1S/C24H30F2N8O3S2/c1-4-14(2)22(35)33-8-7-32(12-15(33)3)18-9-16(39(36,37)31-24(13-27)5-6-24)10-19-17(18)11-30-34(19)23(29)38-21(28)20(25)26/h9-11,14-15,20,28-29,31H,4-8,12H2,1-3H3/b28-21+,29-23- |
| InChIKey | IKYQNNVWFYPHNG-ZDYJHWTBSA-N |
| XLogP | 3.21 |
| TPSA | 159.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.69 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|