C31H38N2O5 — CID 15670938
N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[2-(dimethylamino)ethyl]-3,3-bis(4-methoxyphenyl)prop-2-enamide (PubChem CID 15670938) has the molecular formula C31H38N2O5 and a molecular weight of 518.65 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[2-(dimethylamino)ethyl]-3,3-bis(4-methoxyphenyl)prop-2-enamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[2-(dimethylamino)ethyl]-3,3-bis(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 15670938 |
| Molecular Formula | C31H38N2O5 |
| Molecular Weight | 518.65 g/mol |
| Exact Mass | 518.28 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-N-[2-(dimethylamino)ethyl]-3,3-bis(4-methoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(C(=CC(=O)N(CCc2ccc(OC)c(OC)c2)CCN(C)C)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C31H38N2O5/c1-32(2)19-20-33(18-17-23-7-16-29(37-5)30(21-23)38-6)31(34)22-28(24-8-12-26(35-3)13-9-24)25-10-14-27(36-4)15-11-25/h7-16,21-22H,17-20H2,1-6H3 |
| InChIKey | PJHXCWVMEUPUFN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 60.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.65 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|