About heptadecan-9-yl 8-[4-decoxycarbonyloxybutyl(ethyl)amino]octanoate;molybdenum
heptadecan-9-yl 8-[4-decoxycarbonyloxybutyl(ethyl)amino]octanoate;molybdenum (PubChem CID 156709898) has the molecular formula C42H82MoNO5-
and a molecular weight of 777.06 g/mol. Its IUPAC name is heptadecan-9-yl 8-[4-decoxycarbonyloxybutyl(ethyl)amino]octanoate;molybdenum.
Molecular Properties
| Compound Name | heptadecan-9-yl 8-[4-decoxycarbonyloxybutyl(ethyl)amino]octanoate;molybdenum |
| PubChem CID | 156709898 |
| Molecular Formula | C42H82MoNO5- |
| Molecular Weight | 777.06 g/mol |
| Exact Mass | 778.53 |
| IUPAC Name | heptadecan-9-yl 8-[4-decoxycarbonyloxybutyl(ethyl)amino]octanoate;molybdenum |
| SMILES | [CH2-]CN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCCOC(=O)OCCCCCCCCCC.[Mo] |
| InChI | InChI=1S/C42H82NO5.Mo/c1-5-9-12-15-18-19-25-31-38-46-42(45)47-39-32-30-37-43(8-4)36-29-24-20-23-28-35-41(44)48-40(33-26-21-16-13-10-6-2)34-27-22-17-14-11-7-3;/h40H,4-39H2,1-3H3;/q-1; |
| InChIKey | JICXYAPUUARXQL-UHFFFAOYSA-N |
| XLogP | 12.95 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 777.06 |
| LogP ≤ 5 | 12.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze heptadecan-9-yl 8-[4-decoxycarbonyloxybutyl(ethyl)amino]octanoate;molybdenum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptadecan-9-yl 8-[4-decoxycarbonyloxybutyl(ethyl)amino]octanoate;molybdenum?
The IUPAC name of heptadecan-9-yl 8-[4-decoxycarbonyloxybutyl(ethyl)amino]octanoate;molybdenum (CID 156709898) is heptadecan-9-yl 8-[4-decoxycarbonyloxybutyl(ethyl)amino]octanoate;molybdenum.
What is the SMILES notation for heptadecan-9-yl 8-[4-decoxycarbonyloxybutyl(ethyl)amino]octanoate;molybdenum?
The canonical SMILES for heptadecan-9-yl 8-[4-decoxycarbonyloxybutyl(ethyl)amino]octanoate;molybdenum is [CH2-]CN(CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC)CCCCOC(=O)OCCCCCCCCCC.[Mo].
What is the InChIKey of heptadecan-9-yl 8-[4-decoxycarbonyloxybutyl(ethyl)amino]octanoate;molybdenum?
The InChIKey is JICXYAPUUARXQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H82NO5.Mo/c1-5-9-12-15-18-19-25-31-38-46-42(45)47-39-32-30-37-43(8-4)36-29-24-20-23-28-35-41(44)48-40(33-26-21-16-13-10-6-2)34-27-22-17-14-11-7-3;/h40H,4-39H2,1-3H3;/q-1;.
What are the key properties of heptadecan-9-yl 8-[4-decoxycarbonyloxybutyl(ethyl)amino]octanoate;molybdenum?
heptadecan-9-yl 8-[4-decoxycarbonyloxybutyl(ethyl)amino]octanoate;molybdenum has a molecular weight of 777.06 g/mol, XLogP of 12.95, 38 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for heptadecan-9-yl 8-[4-decoxycarbonyloxybutyl(ethyl)amino]octanoate;molybdenum is sourced from PubChem (CID 156709898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).