C26H28FN3O4S — CID 156711270
3-butoxy-5-[4-[2-(7-fluoro-4-methoxy-2-methylindol-1-yl)ethylamino]-2-pyridinyl]thiophene-2-carboxylic acid (PubChem CID 156711270) has the molecular formula C26H28FN3O4S and a molecular weight of 497.59 g/mol. Its IUPAC name is 3-butoxy-5-[4-[2-(7-fluoro-4-methoxy-2-methylindol-1-yl)ethylamino]-2-pyridinyl]thiophene-2-carboxylic acid.
| Compound Name | 3-butoxy-5-[4-[2-(7-fluoro-4-methoxy-2-methylindol-1-yl)ethylamino]-2-pyridinyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 156711270 |
| Molecular Formula | C26H28FN3O4S |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | 3-butoxy-5-[4-[2-(7-fluoro-4-methoxy-2-methylindol-1-yl)ethylamino]-2-pyridinyl]thiophene-2-carboxylic acid |
| SMILES | CCCCOc1cc(-c2cc(NCCn3c(C)cc4c(OC)ccc(F)c43)ccn2)sc1C(=O)O |
| InChI | InChI=1S/C26H28FN3O4S/c1-4-5-12-34-22-15-23(35-25(22)26(31)32)20-14-17(8-9-29-20)28-10-11-30-16(2)13-18-21(33-3)7-6-19(27)24(18)30/h6-9,13-15H,4-5,10-12H2,1-3H3,(H,28,29)(H,31,32) |
| InChIKey | RRIOFMAWGJEBJA-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|