C30H36F4N4O5 — CID 156712708
4-[3-[4-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxybenzoic acid;1-(3-fluoropiperidin-1-yl)-3-methoxypropan-2-ol (PubChem CID 156712708) has the molecular formula C30H36F4N4O5 and a molecular weight of 608.63 g/mol. Its IUPAC name is 4-[3-[4-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxybenzoic acid;1-(3-fluoropiperidin-1-yl)-3-methoxypropan-2-ol.
| Compound Name | 4-[3-[4-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxybenzoic acid;1-(3-fluoropiperidin-1-yl)-3-methoxypropan-2-ol |
|---|---|
| PubChem CID | 156712708 |
| Molecular Formula | C30H36F4N4O5 |
| Molecular Weight | 608.63 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | 4-[3-[4-amino-1-(2,2,2-trifluoroethyl)indol-2-yl]prop-2-ynylamino]-3-methoxybenzoic acid;1-(3-fluoropiperidin-1-yl)-3-methoxypropan-2-ol |
| SMILES | COCC(O)CN1CCCC(F)C1.COc1cc(C(=O)O)ccc1NCC#Cc1cc2c(N)cccc2n1CC(F)(F)F |
| InChI | InChI=1S/C21H18F3N3O3.C9H18FNO2/c1-30-19-10-13(20(28)29)7-8-17(19)26-9-3-4-14-11-15-16(25)5-2-6-18(15)27(14)12-21(22,23)24;1-13-7-9(12)6-11-4-2-3-8(10)5-11/h2,5-8,10-11,26H,9,12,25H2,1H3,(H,28,29);8-9,12H,2-7H2,1H3 |
| InChIKey | XISNJVFHUYPBEV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 122.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.63 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|