About methanamine;2-methyloxan-4-amine
methanamine;2-methyloxan-4-amine (PubChem CID 156712849) has the molecular formula C7H18N2O
and a molecular weight of 146.23 g/mol. Its IUPAC name is methanamine;2-methyloxan-4-amine.
Molecular Properties
| Compound Name | methanamine;2-methyloxan-4-amine |
| PubChem CID | 156712849 |
| Molecular Formula | C7H18N2O |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.14 |
| IUPAC Name | methanamine;2-methyloxan-4-amine |
| SMILES | CC1CC(N)CCO1.CN |
| InChI | InChI=1S/C6H13NO.CH5N/c1-5-4-6(7)2-3-8-5;1-2/h5-6H,2-4,7H2,1H3;2H2,1H3 |
| InChIKey | KURXASQPPAVKDU-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methanamine;2-methyloxan-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;2-methyloxan-4-amine?
The IUPAC name of methanamine;2-methyloxan-4-amine (CID 156712849) is methanamine;2-methyloxan-4-amine.
What is the SMILES notation for methanamine;2-methyloxan-4-amine?
The canonical SMILES for methanamine;2-methyloxan-4-amine is CC1CC(N)CCO1.CN.
What is the InChIKey of methanamine;2-methyloxan-4-amine?
The InChIKey is KURXASQPPAVKDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO.CH5N/c1-5-4-6(7)2-3-8-5;1-2/h5-6H,2-4,7H2,1H3;2H2,1H3.
What are the key properties of methanamine;2-methyloxan-4-amine?
methanamine;2-methyloxan-4-amine has a molecular weight of 146.23 g/mol, XLogP of 0.09, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;2-methyloxan-4-amine is sourced from PubChem (CID 156712849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).