About ethane;ethyl (Z)-2-amino-3-(4-bromo-2-methylphenyl)prop-2-enoate
ethane;ethyl (Z)-2-amino-3-(4-bromo-2-methylphenyl)prop-2-enoate (PubChem CID 156715582) has the molecular formula C16H26BrNO2
and a molecular weight of 344.29 g/mol. Its IUPAC name is ethane;ethyl (Z)-2-amino-3-(4-bromo-2-methylphenyl)prop-2-enoate.
Molecular Properties
| Compound Name | ethane;ethyl (Z)-2-amino-3-(4-bromo-2-methylphenyl)prop-2-enoate |
| PubChem CID | 156715582 |
| Molecular Formula | C16H26BrNO2 |
| Molecular Weight | 344.29 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | ethane;ethyl (Z)-2-amino-3-(4-bromo-2-methylphenyl)prop-2-enoate |
| SMILES | CC.CC.CCOC(=O)/C(N)=C/c1ccc(Br)cc1C |
| InChI | InChI=1S/C12H14BrNO2.2C2H6/c1-3-16-12(15)11(14)7-9-4-5-10(13)6-8(9)2;2*1-2/h4-7H,3,14H2,1-2H3;2*1-2H3/b11-7-;; |
| InChIKey | MSIQTOQBOAKMMN-FJJKMGSJSA-N |
| XLogP | 4.67 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.29 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethyl (Z)-2-amino-3-(4-bromo-2-methylphenyl)prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethyl (Z)-2-amino-3-(4-bromo-2-methylphenyl)prop-2-enoate?
The IUPAC name of ethane;ethyl (Z)-2-amino-3-(4-bromo-2-methylphenyl)prop-2-enoate (CID 156715582) is ethane;ethyl (Z)-2-amino-3-(4-bromo-2-methylphenyl)prop-2-enoate.
What is the SMILES notation for ethane;ethyl (Z)-2-amino-3-(4-bromo-2-methylphenyl)prop-2-enoate?
The canonical SMILES for ethane;ethyl (Z)-2-amino-3-(4-bromo-2-methylphenyl)prop-2-enoate is CC.CC.CCOC(=O)/C(N)=C/c1ccc(Br)cc1C.
What is the InChIKey of ethane;ethyl (Z)-2-amino-3-(4-bromo-2-methylphenyl)prop-2-enoate?
The InChIKey is MSIQTOQBOAKMMN-FJJKMGSJSA-N. The full InChI is InChI=1S/C12H14BrNO2.2C2H6/c1-3-16-12(15)11(14)7-9-4-5-10(13)6-8(9)2;2*1-2/h4-7H,3,14H2,1-2H3;2*1-2H3/b11-7-;;.
What are the key properties of ethane;ethyl (Z)-2-amino-3-(4-bromo-2-methylphenyl)prop-2-enoate?
ethane;ethyl (Z)-2-amino-3-(4-bromo-2-methylphenyl)prop-2-enoate has a molecular weight of 344.29 g/mol, XLogP of 4.67, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethyl (Z)-2-amino-3-(4-bromo-2-methylphenyl)prop-2-enoate is sourced from PubChem (CID 156715582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).